3,5-bis(tert-butyldiphenylsilyloxy)benzyl alcohol structure
|
Common Name | 3,5-bis(tert-butyldiphenylsilyloxy)benzyl alcohol | ||
|---|---|---|---|---|
| CAS Number | 182250-70-0 | Molecular Weight | 616.936 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 631.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C39H44O3Si2 | Melting Point | 108ºC | |
| MSDS | N/A | Flash Point | 335.8±31.5 °C | |
| Name | [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 631.6±55.0 °C at 760 mmHg |
| Melting Point | 108ºC |
| Molecular Formula | C39H44O3Si2 |
| Molecular Weight | 616.936 |
| Flash Point | 335.8±31.5 °C |
| Exact Mass | 616.282898 |
| PSA | 38.69000 |
| LogP | 12.81 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | SDDISUZNVYXXHS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](Oc1cc(CO)cc(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1)(c1ccccc1)c1ccccc1 |
|
~%
3,5-bis(tert-bu... CAS#:182250-70-0 |
| Literature: Chemical Communications, , # 18 p. 2143 - 2144 |
|
~%
3,5-bis(tert-bu... CAS#:182250-70-0 |
| Literature: Journal of Organic Chemistry, , vol. 65, # 22 p. 7612 - 7617 |
|
~%
3,5-bis(tert-bu... CAS#:182250-70-0 |
| Literature: Journal of Organic Chemistry, , vol. 65, # 22 p. 7612 - 7617 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzenemethanol, 3,5-bis[[(1,1-dimethylethyl)diphenylsilyl]oxy]- |
| MFCD02093440 |
| (3,5-Bis{[tert-butyl(diphenyl)silyl]oxy}phenyl)methanol |
| B2052 |
| (3,5-Bis{[(2-methyl-2-propanyl)(diphenyl)silyl]oxy}phenyl)methanol |
| 3,5-Bis(tert-butyldiphenylsilyloxy)benzyl Alcohol |
| 3,5-Di-tert-butyldiphenylsilyloxybenzylalcohol |