N-(amino-phenylmethoxy-phosphoryl)-2-chloro-N-(2-chloroethyl)ethanamine structure
|
Common Name | N-(amino-phenylmethoxy-phosphoryl)-2-chloro-N-(2-chloroethyl)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 18228-80-3 | Molecular Weight | 311.14500 | |
| Density | 1.318g/cm3 | Boiling Point | 427.7ºC at 760 mmHg | |
| Molecular Formula | C11H17Cl2N2O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.4ºC | |
| Name | N-[amino(phenylmethoxy)phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine |
|---|
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 427.7ºC at 760 mmHg |
| Molecular Formula | C11H17Cl2N2O2P |
| Molecular Weight | 311.14500 |
| Flash Point | 212.4ºC |
| Exact Mass | 310.04000 |
| PSA | 65.37000 |
| LogP | 3.74990 |
| Vapour Pressure | 1.61E-07mmHg at 25°C |
| Index of Refraction | 1.55 |
| InChIKey | JSZWFLWJWIMZLD-UHFFFAOYSA-N |
| SMILES | NP(=O)(OCc1ccccc1)N(CCCl)CCCl |
|
~%
N-(amino-phenyl... CAS#:18228-80-3 |
| Literature: Kwon, Chul-Hoon; Moon, Ki-Young; Baturay, Nesrine; Shirota, Frances N. Journal of Medicinal Chemistry, 1991 , vol. 34, # 2 p. 588 - 592 |
|
~%
N-(amino-phenyl... CAS#:18228-80-3 |
| Literature: Friedman,O.M. et al. J. Med. Chem., 1963 , vol. 6, p. 50 - 58 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |