octadecane-9,10-dione
octadecane-9,10-dione structure
|
Common Name | octadecane-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 18229-30-6 | Molecular Weight | 282.46100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | octadecane-9,10-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H34O2 |
|---|---|
| Molecular Weight | 282.46100 |
| Exact Mass | 282.25600 |
| PSA | 34.14000 |
| LogP | 5.62580 |
| InChIKey | YSDLVQIOIXINJC-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)C(=O)CCCCCCCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9,10-octadecanedione |
| dioctyl ethanedione |
| bipelargonoyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 18229-30-6? |
| A: Chinese name of 18229-30-6 is 18229-30-6. |
| Q: What is the CAS number of octadecane-9,10-dione? |
| A: CAS number of octadecane-9,10-dione is 18229-30-6. |
| Q: What is the InChIKey of octadecane-9,10-dione? |
| A: InChIKey of octadecane-9,10-dione is YSDLVQIOIXINJC-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of octadecane-9,10-dione? |
| A: SMILES notation of octadecane-9,10-dione is CCCCCCCCC(=O)C(=O)CCCCCCCC. |
| Q: What is the molecular formula of octadecane-9,10-dione? |
| A: Molecular formula of octadecane-9,10-dione is C18H34O2. |
| Q: What is the English name of octadecane-9,10-dione? |
| A: The English name of octadecane-9,10-dione is octadecane-9,10-dione. |
| Q: What is the LogP of octadecane-9,10-dione? |
| A: LogP of octadecane-9,10-dione is 5.62580. |
| Q: What is the molecular weight of octadecane-9,10-dione? |
| A: Molecular weight of octadecane-9,10-dione is 282.46100. |
| Q: What English synonyms does octadecane-9,10-dione have? |
| A: English synonyms of octadecane-9,10-dione: 9,10-octadecanedione, dioctyl ethanedione, bipelargonoyl. |
| Q: What is the polar surface area (PSA) of octadecane-9,10-dione? |
| A: Polar surface area (PSA) of octadecane-9,10-dione is 34.14000. |