1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane
![1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane Structure](https://image.chemsrc.com/caspic/133/182306-47-4.png)
1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane structure
|
Common Name | 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane | ||
|---|---|---|---|---|
| CAS Number | 182306-47-4 | Molecular Weight | 245.36300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H23N3 |
|---|---|
| Molecular Weight | 245.36300 |
| Exact Mass | 245.18900 |
| PSA | 27.30000 |
| LogP | 1.91990 |
| InChIKey | JTHCCAYHVVDKON-UHFFFAOYSA-N |
| SMILES | C=Cc1ccc(CN2CCNCCNCC2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~75%
1-[(4-ethenylph... CAS#:182306-47-4 |
| Literature: Lo, H. Christine; Chen, Hong; Fish, Richard H. European Journal of Inorganic Chemistry, 2001 , # 9 p. 2217 - 2220 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane? |
| A: CAS number of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane is 182306-47-4. |
| Q: What is the SMILES notation of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane? |
| A: SMILES notation of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane is C=Cc1ccc(CN2CCNCCNCC2)cc1. |
| Q: What is the English name of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane? |
| A: The English name of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane is 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane. |
| Q: What is the molecular weight of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane? |
| A: Molecular weight of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane is 245.36300. |
| Q: What is the InChIKey of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane? |
| A: InChIKey of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane is JTHCCAYHVVDKON-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane? |
| A: Molecular formula of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane is C15H23N3. |
| Q: What is the polar surface area (PSA) of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane? |
| A: Polar surface area (PSA) of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane is 27.30000. |
| Q: What is the Chinese name of 182306-47-4? |
| A: Chinese name of 182306-47-4 is 182306-47-4. |
| Q: What is the LogP of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane? |
| A: LogP of 1-[(4-ethenylphenyl)methyl]-1,4,7-triazonane is 1.91990. |