2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt
Modify Date: 2025-09-10 08:29:51
2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt structure
|
Common Name | 2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt | ||
|---|---|---|---|---|
| CAS Number | 1823060-24-7 | Molecular Weight | 266.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3ClF3NaO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H3ClF3NaO2S |
|---|---|
| Molecular Weight | 266.60 |
| InChIKey | LKGPJDHCMSVSAS-UHFFFAOYSA-M |
| SMILES | O=S([O-])c1ccc(C(F)(F)F)cc1Cl.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt? |
| A: Molecular formula of 2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt is C7H3ClF3NaO2S. |
| Q: What is the English name of 2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt? |
| A: The English name of 2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt is 2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt. |
| Q: What is the molecular weight of 2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt? |
| A: Molecular weight of 2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt is 266.60. |
| Q: What is the InChIKey of 2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt? |
| A: InChIKey of 2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt is LKGPJDHCMSVSAS-UHFFFAOYSA-M. |
| Q: What is the Chinese name of 1823060-24-7? |
| A: Chinese name of 1823060-24-7 is 1823060-24-7. |
| Q: What is the SMILES notation of 2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt? |
| A: SMILES notation of 2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt is O=S([O-])c1ccc(C(F)(F)F)cc1Cl.[Na+]. |
| Q: What is the CAS number of 2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt? |
| A: CAS number of 2-Chloro-4-(trifluoromethyl)benzenesulfinic acid sodium salt is 1823060-24-7. |