Benzyl 3-hydroxy-3-phenylpropylcarbamate
Modify Date: 2026-07-06 11:01:04
Benzyl 3-hydroxy-3-phenylpropylcarbamate structure
|
Common Name | Benzyl 3-hydroxy-3-phenylpropylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 1823228-28-9 | Molecular Weight | 285.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzyl 3-hydroxy-3-phenylpropylcarbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H19NO3 |
|---|---|
| Molecular Weight | 285.34 |
| InChIKey | SBXWWLKCTKHLKV-UHFFFAOYSA-N |
| SMILES | O=C(NCCC(O)c1ccccc1)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Benzyl 3-hydroxy-3-phenylpropylcarbamate? |
| A: CAS number of Benzyl 3-hydroxy-3-phenylpropylcarbamate is 1823228-28-9. |
| Q: What is the InChIKey of Benzyl 3-hydroxy-3-phenylpropylcarbamate? |
| A: InChIKey of Benzyl 3-hydroxy-3-phenylpropylcarbamate is SBXWWLKCTKHLKV-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Benzyl 3-hydroxy-3-phenylpropylcarbamate? |
| A: Molecular formula of Benzyl 3-hydroxy-3-phenylpropylcarbamate is C17H19NO3. |
| Q: What is the Chinese name of 1823228-28-9? |
| A: Chinese name of 1823228-28-9 is 1823228-28-9. |
| Q: What is the English name of Benzyl 3-hydroxy-3-phenylpropylcarbamate? |
| A: The English name of Benzyl 3-hydroxy-3-phenylpropylcarbamate is Benzyl 3-hydroxy-3-phenylpropylcarbamate. |
| Q: What is the molecular weight of Benzyl 3-hydroxy-3-phenylpropylcarbamate? |
| A: Molecular weight of Benzyl 3-hydroxy-3-phenylpropylcarbamate is 285.34. |
| Q: What is the SMILES notation of Benzyl 3-hydroxy-3-phenylpropylcarbamate? |
| A: SMILES notation of Benzyl 3-hydroxy-3-phenylpropylcarbamate is O=C(NCCC(O)c1ccccc1)OCc1ccccc1. |