1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one
Modify Date: 2025-11-24 21:49:41
1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one structure
|
Common Name | 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 18234-58-7 | Molecular Weight | 214.21700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10O3 |
|---|---|
| Molecular Weight | 214.21700 |
| Exact Mass | 214.06300 |
| PSA | 50.44000 |
| LogP | 2.88130 |
| InChIKey | CTPZVSOXBBLRFZ-UHFFFAOYSA-N |
| SMILES | O=C(C=Cc1ccccc1O)c1ccco1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one? |
| A: Molecular weight of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one is 214.21700. |
| Q: What is the InChIKey of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one? |
| A: InChIKey of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one is CTPZVSOXBBLRFZ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one? |
| A: Polar surface area (PSA) of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one is 50.44000. |
| Q: What is the CAS number of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one? |
| A: CAS number of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one is 18234-58-7. |
| Q: What is the SMILES notation of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one? |
| A: SMILES notation of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one is O=C(C=Cc1ccccc1O)c1ccco1. |
| Q: What is the LogP of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one? |
| A: LogP of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one is 2.88130. |
| Q: What is the Chinese name of 18234-58-7? |
| A: Chinese name of 18234-58-7 is 18234-58-7. |
| Q: What is the English name of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one? |
| A: The English name of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one is 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one. |
| Q: What is the molecular formula of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one? |
| A: Molecular formula of 1-(furan-2-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one is C13H10O3. |