1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl)
Modify Date: 2025-12-08 20:52:41
1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl) structure
|
Common Name | 1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl) | ||
|---|---|---|---|---|
| CAS Number | 1823402-60-3 | Molecular Weight | 220.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H24N2 |
|---|---|
| Molecular Weight | 220.35 |
| InChIKey | IINAGNOQBJEXEZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(N)c(N)c1C(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl)? |
| A: InChIKey of 1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl) is IINAGNOQBJEXEZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl)? |
| A: Molecular formula of 1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl) is C14H24N2. |
| Q: What is the CAS number of 1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl)? |
| A: CAS number of 1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl) is 1823402-60-3. |
| Q: What is the molecular weight of 1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl)? |
| A: Molecular weight of 1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl) is 220.35. |
| Q: What is the SMILES notation of 1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl)? |
| A: SMILES notation of 1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl) is CC(C)(C)c1ccc(N)c(N)c1C(C)(C)C. |
| Q: What is the Chinese name of 1823402-60-3? |
| A: Chinese name of 1823402-60-3 is 1823402-60-3. |
| Q: What is the English name of 1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl)? |
| A: The English name of 1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl) is 1,2-Benzenediamine, 3,4-bis(1,1-dimethylethyl). |