[(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid
Modify Date: 2026-09-13 15:23:19
![[(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid Structure](https://www.chemsrc.com/extcaspic/296/1823487-53-1.png)
[(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid structure
|
Common Name | [(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid | ||
|---|---|---|---|---|
| CAS Number | 1823487-53-1 | Molecular Weight | 225.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19NO3 |
|---|---|
| Molecular Weight | 225.28 |
| InChIKey | DVKHJXNJCBMZJT-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)O)CC(C2CCCCC2)=NO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1823487-53-1? |
| A: Chinese name of 1823487-53-1 is 1823487-53-1. |
| Q: What is the CAS number of [(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid? |
| A: CAS number of [(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid is 1823487-53-1. |
| Q: What is the English name of [(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid? |
| A: The English name of [(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid is [(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid. |
| Q: What is the SMILES notation of [(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid? |
| A: SMILES notation of [(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid is CC1(CC(=O)O)CC(C2CCCCC2)=NO1. |
| Q: What is the molecular formula of [(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid? |
| A: Molecular formula of [(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid is C12H19NO3. |
| Q: What is the molecular weight of [(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid? |
| A: Molecular weight of [(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid is 225.28. |
| Q: What is the InChIKey of [(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid? |
| A: InChIKey of [(5RS)-3-Cyclohexyl-5-methyl-4,5-dihydro-1,2-oxazol-5-yl]acetic Acid is DVKHJXNJCBMZJT-UHFFFAOYSA-N. |