1,3,4-Thiadiazolium,5-(4-chlorophenyl)-4-phenyl-2-thioxo-, inner salt structure
|
Common Name | 1,3,4-Thiadiazolium,5-(4-chlorophenyl)-4-phenyl-2-thioxo-, inner salt | ||
|---|---|---|---|---|
| CAS Number | 18237-54-2 | Molecular Weight | 304.81800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9ClN2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(4-chlorophenyl)-4-phenyl-1,3,4-thiadiazol-4-ium-2-thiolate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H9ClN2S2 |
|---|---|
| Molecular Weight | 304.81800 |
| Exact Mass | 303.99000 |
| PSA | 78.15000 |
| LogP | 4.98370 |
| InChIKey | NWILPNCFXVUBDG-UHFFFAOYSA-N |
| SMILES | [S-]c1n[n+](-c2ccccc2)c(-c2ccc(Cl)cc2)s1 |
|
~%
1,3,4-Thiadiazo... CAS#:18237-54-2 |
| Literature: Stewart; Kier Journal of pharmaceutical sciences, 1965 , vol. 54, # 5 p. 731 - 734 |
|
~%
1,3,4-Thiadiazo... CAS#:18237-54-2 |
| Literature: Baker et al. Journal of the Chemical Society, 1951 , p. 289 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-(4-chloro-phenyl)-4-phenyl-2-thioxo-3,4-dihydro-2H-[1,3,4]thiadiazolium betaine |
| 5-(4-Chlor-phenyl)-4-phenyl-2-thioxo-3,4-dihydro-2H-[1,3,4]thiadiazolium-betain |
| 4-Phenyl-5-(4'chlorphenyl)-1,3,4-thiadiazolium-2-thiolat |
| 5-(p-Chlorphenyl)-4-phenyl-2-mercapto-1,3,4-thiadiazolium-betain |
| 2-(4-chloro-phenyl)-3-phenyl-5-thioxo-4,5-dihydro-[1,3,4]thiadiazolium betaine |
| 2-(4-chlorophenyl)-3-phenyl-1,3,4-thiadiazol-3-ium-5-thiolate |