1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro
Modify Date: 2025-09-10 20:04:50
1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro structure
|
Common Name | 1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro | ||
|---|---|---|---|---|
| CAS Number | 1823902-87-9 | Molecular Weight | 194.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H22O |
|---|---|
| Molecular Weight | 194.31 |
| InChIKey | HXODUXKVNRVDRX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2=C(CCC2O)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro? |
| A: InChIKey of 1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro is HXODUXKVNRVDRX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1823902-87-9? |
| A: Chinese name of 1823902-87-9 is 1823902-87-9. |
| Q: What is the SMILES notation of 1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro? |
| A: SMILES notation of 1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro is CC(C)(C)C1CCC2=C(CCC2O)C1. |
| Q: What is the CAS number of 1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro? |
| A: CAS number of 1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro is 1823902-87-9. |
| Q: What is the molecular formula of 1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro? |
| A: Molecular formula of 1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro is C13H22O. |
| Q: What is the molecular weight of 1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro? |
| A: Molecular weight of 1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro is 194.31. |
| Q: What is the English name of 1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro? |
| A: The English name of 1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro is 1H-Inden-1-ol, 5-(1,1-dimethylethyl)-2,3,4,5,6,7-hexahydro. |