[1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester
Modify Date: 2025-09-04 18:24:05
![[1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester Structure](https://www.chemsrc.com/extcaspic/285/1823977-95-2.png)
[1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester structure
|
Common Name | [1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1823977-95-2 | Molecular Weight | 304.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H24N2O3 |
|---|---|
| Molecular Weight | 304.4 |
| InChIKey | QOELHSNUZKKHBQ-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)N1CCC(N2CCC(CO)C2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of [1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester? |
| A: CAS number of [1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester is 1823977-95-2. |
| Q: What is the Chinese name of 1823977-95-2? |
| A: Chinese name of 1823977-95-2 is 1823977-95-2. |
| Q: What is the InChIKey of [1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester? |
| A: InChIKey of [1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester is QOELHSNUZKKHBQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of [1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester? |
| A: SMILES notation of [1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester is O=C(OCc1ccccc1)N1CCC(N2CCC(CO)C2)C1. |
| Q: What is the molecular weight of [1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester? |
| A: Molecular weight of [1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester is 304.4. |
| Q: What is the molecular formula of [1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester? |
| A: Molecular formula of [1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester is C17H24N2O3. |
| Q: What is the English name of [1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester? |
| A: The English name of [1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester is [1,3'-Bipyrrolidine]-1'-carboxylic acid, 3-(hydroxymethyl)-, phenylmethyl ester. |