Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy
Modify Date: 2025-09-09 12:27:06
Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy structure
|
Common Name | Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy | ||
|---|---|---|---|---|
| CAS Number | 1823981-25-4 | Molecular Weight | 290.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12BrNO4 |
|---|---|
| Molecular Weight | 290.11 |
| InChIKey | GMIFTPCEMXRFKN-UHFFFAOYSA-N |
| SMILES | COc1cc(Br)c(C(N)CC(=O)O)cc1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy? |
| A: SMILES notation of Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy is COc1cc(Br)c(C(N)CC(=O)O)cc1O. |
| Q: What is the Chinese name of 1823981-25-4? |
| A: Chinese name of 1823981-25-4 is 1823981-25-4. |
| Q: What is the molecular weight of Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy? |
| A: Molecular weight of Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy is 290.11. |
| Q: What is the English name of Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy? |
| A: The English name of Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy is Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy. |
| Q: What is the InChIKey of Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy? |
| A: InChIKey of Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy is GMIFTPCEMXRFKN-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy? |
| A: Molecular formula of Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy is C10H12BrNO4. |
| Q: What is the CAS number of Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy? |
| A: CAS number of Benzenepropanoic acid, I(2)-amino-2-bromo-5-hydroxy-4-methoxy is 1823981-25-4. |