2-Chloro-4-isopropylamino-6-(3-methoxypropylamino)-1,3,5-triazine structure
|
Common Name | 2-Chloro-4-isopropylamino-6-(3-methoxypropylamino)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 1824-09-5 | Molecular Weight | 259.73600 | |
| Density | 1.241g/cm3 | Boiling Point | 418.2ºC at 760 mmHg | |
| Molecular Formula | C10H18ClN5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.7ºC | |
| Name | mesoprazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.241g/cm3 |
|---|---|
| Boiling Point | 418.2ºC at 760 mmHg |
| Molecular Formula | C10H18ClN5O |
| Molecular Weight | 259.73600 |
| Flash Point | 206.7ºC |
| Exact Mass | 259.12000 |
| PSA | 78.42000 |
| LogP | 0.63750 |
| Vapour Pressure | 3.35E-07mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | PMYBBBROJPQQQV-UHFFFAOYSA-N |
| SMILES | COCCCNc1nc(Cl)nc(NC(C)C)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| Mesoprazine |
| 6-chloro-4-N-(3-methoxypropyl)-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| UNII-X8902D4L2K |
| 6-chloro-N-(3-methoxypropyl)-N’-(1-methylethyl)-1,3,5-triazine-2,4-diamine |
| 6-chloro-N2-isopropyl-N4-(3-methoxypropyl)-1,3,5-triazine-2,4-diamine |
| 6-chloro-N2-(3-methoxypropyl)-N4-(propan-2-yl)-1,3,5-triazine-2,4-diamine |