1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro
Modify Date: 2026-07-16 10:37:27
1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro structure
|
Common Name | 1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro | ||
|---|---|---|---|---|
| CAS Number | 1824065-63-5 | Molecular Weight | 240.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8ClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8ClF3O2 |
|---|---|
| Molecular Weight | 240.60 |
| InChIKey | WFBQINGHPBSQBB-UHFFFAOYSA-N |
| SMILES | OCC(O)(c1cccc(Cl)c1)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro? |
| A: SMILES notation of 1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro is OCC(O)(c1cccc(Cl)c1)C(F)(F)F. |
| Q: What is the InChIKey of 1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro? |
| A: InChIKey of 1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro is WFBQINGHPBSQBB-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro? |
| A: Molecular formula of 1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro is C9H8ClF3O2. |
| Q: What is the CAS number of 1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro? |
| A: CAS number of 1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro is 1824065-63-5. |
| Q: What is the Chinese name of 1824065-63-5? |
| A: Chinese name of 1824065-63-5 is 1824065-63-5. |
| Q: What is the English name of 1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro? |
| A: The English name of 1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro is 1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro. |
| Q: What is the molecular weight of 1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro? |
| A: Molecular weight of 1,2-Propanediol, 2-(3-chlorophenyl)-3,3,3-trifluoro is 240.60. |