Bis(4-methylbenzyl) oxalate structure
|
Common Name | Bis(4-methylbenzyl) oxalate | ||
|---|---|---|---|---|
| CAS Number | 18241-31-1 | Molecular Weight | 298.33300 | |
| Density | 1.167 g/cm3 | Boiling Point | 418.7ºC at 760 mmHg | |
| Molecular Formula | C18H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.6ºC | |
| Name | bis[(4-methylphenyl)methyl] oxalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167 g/cm3 |
|---|---|
| Boiling Point | 418.7ºC at 760 mmHg |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.33300 |
| Flash Point | 183.6ºC |
| Exact Mass | 298.12100 |
| PSA | 52.60000 |
| LogP | 3.09000 |
| Vapour Pressure | 3.21E-07mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | FPFZBTUMXCSRLU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(COC(=O)C(=O)OCc2ccc(C)cc2)cc1 |
| HS Code | 2917119000 |
|---|
|
~%
Bis(4-methylben... CAS#:18241-31-1 |
| Literature: Journal of the American Chemical Society, , vol. 90, p. 2839 - 2842 |
| HS Code | 2917119000 |
|---|---|
| Summary | 2917119000 oxalic acid salts and esters VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| p-methylbenzyl oxalate |
| Bis(4-methylbenzyl) oxalate |