Fmoc-(D-Phe)-OSu structure
|
Common Name | Fmoc-(D-Phe)-OSu | ||
|---|---|---|---|---|
| CAS Number | 182410-73-7 | Molecular Weight | 484.50 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-(D-Phe)-OSuFmoc-(D-Phe)-Osu is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Fmoc-(D-Phe)-OSu |
|---|
| Description | Fmoc-(D-Phe)-Osu is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| References |
| Molecular Formula | C28H24N2O6 |
|---|---|
| Molecular Weight | 484.50 |
| InChIKey | VLXHZQQUTCVLGU-XMMPIXPASA-N |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)ON1C(=O)CCC1=O)OCC1c2ccccc2-c2ccccc21 |