(2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate
Modify Date: 2026-07-05 23:19:59
(2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate structure
|
Common Name | (2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1824507-86-9 | Molecular Weight | 243.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21NO4 |
|---|---|
| Molecular Weight | 243.30 |
| InChIKey | CTIQWEXQRFSHLG-UHFFFAOYSA-N |
| SMILES | CC(C)C1C(O)CC(=O)N1C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate? |
| A: The English name of (2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate is (2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate. |
| Q: What is the molecular weight of (2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate? |
| A: Molecular weight of (2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate is 243.30. |
| Q: What is the InChIKey of (2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate? |
| A: InChIKey of (2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate is CTIQWEXQRFSHLG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of (2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate? |
| A: Molecular formula of (2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate is C12H21NO4. |
| Q: What is the CAS number of (2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate? |
| A: CAS number of (2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate is 1824507-86-9. |
| Q: What is the SMILES notation of (2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate? |
| A: SMILES notation of (2S)-tert-Butyl 3-hydroxy-2-isopropyl-5-oxopyrrolidine-1-carboxylate is CC(C)C1C(O)CC(=O)N1C(=O)OC(C)(C)C. |
| Q: What is the Chinese name of 1824507-86-9? |
| A: Chinese name of 1824507-86-9 is 1824507-86-9. |