2-chloro-6-phenylmethoxypyridine-4-carboxylic acid structure
|
Common Name | 2-chloro-6-phenylmethoxypyridine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 182483-63-2 | Molecular Weight | 263.67600 | |
| Density | 1.374g/cm3 | Boiling Point | 497.3ºC at 760 mmHg | |
| Molecular Formula | C13H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.6ºC | |
| Name | 2-chloro-6-phenylmethoxypyridine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 497.3ºC at 760 mmHg |
| Molecular Formula | C13H10ClNO3 |
| Molecular Weight | 263.67600 |
| Flash Point | 254.6ºC |
| Exact Mass | 263.03500 |
| PSA | 59.42000 |
| LogP | 3.01220 |
| Vapour Pressure | 1.04E-10mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | KMMINKCWBOCELM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Cl)nc(OCc2ccccc2)c1 |
|
~%
2-chloro-6-phen... CAS#:182483-63-2 |
| Literature: MERCK and CO., INC.; BANYU PHARMACEUTICAL CO., LTD. Patent: WO2008/88692 A2, 2008 ; Location in patent: Page/Page column 125 ; |
| 2-chloro-6-benzyloxypyridine-4-carboxylic acid |
| 2-benzyloxy-6-chloro-isonicotinic acid |