(2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide
Modify Date: 2025-09-09 18:13:55
![(2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide Structure](https://www.chemsrc.com/extcaspic/321/1824971-80-3.png)
(2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide structure
|
Common Name | (2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1824971-80-3 | Molecular Weight | 320.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H20N4O |
|---|---|
| Molecular Weight | 320.4 |
| InChIKey | ROWPBTVUIDOKOR-QGZVFWFLSA-N |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3[nH]2)cc1)C1CCCCN1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide? |
| A: CAS number of (2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide is 1824971-80-3. |
| Q: What is the InChIKey of (2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide? |
| A: InChIKey of (2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide is ROWPBTVUIDOKOR-QGZVFWFLSA-N. |
| Q: What is the English name of (2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide? |
| A: The English name of (2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide is (2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide. |
| Q: What is the Chinese name of 1824971-80-3? |
| A: Chinese name of 1824971-80-3 is 1824971-80-3. |
| Q: What is the molecular weight of (2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide? |
| A: Molecular weight of (2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide is 320.4. |
| Q: What is the SMILES notation of (2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide? |
| A: SMILES notation of (2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide is O=C(Nc1ccc(-c2nc3ccccc3[nH]2)cc1)C1CCCCN1. |
| Q: What is the molecular formula of (2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide? |
| A: Molecular formula of (2R)-N-[4-(1H-1,3-benzodiazol-2-yl)phenyl]piperidine-2-carboxamide is C19H20N4O. |