N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline
Modify Date: 2026-09-28 13:27:31
![N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline Structure](https://www.chemsrc.com/extcaspic/093/1825549-26-5.png)
N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline structure
|
Common Name | N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline | ||
|---|---|---|---|---|
| CAS Number | 1825549-26-5 | Molecular Weight | 246.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11FN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H11FN4O |
|---|---|
| Molecular Weight | 246.24 |
| InChIKey | ISBNFFYYQZUTQF-UHFFFAOYSA-N |
| SMILES | CCc1nnc(CN(C#N)c2ccc(F)cc2)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline? |
| A: The English name of N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline is N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline. |
| Q: What is the molecular weight of N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline? |
| A: Molecular weight of N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline is 246.24. |
| Q: What is the Chinese name of 1825549-26-5? |
| A: Chinese name of 1825549-26-5 is 1825549-26-5. |
| Q: What is the InChIKey of N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline? |
| A: InChIKey of N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline is ISBNFFYYQZUTQF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline? |
| A: Molecular formula of N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline is C12H11FN4O. |
| Q: What is the CAS number of N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline? |
| A: CAS number of N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline is 1825549-26-5. |
| Q: What is the SMILES notation of N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline? |
| A: SMILES notation of N-cyano-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-4-fluoroaniline is CCc1nnc(CN(C#N)c2ccc(F)cc2)o1. |