N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide
Modify Date: 2025-09-09 18:55:12
N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide structure
|
Common Name | N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 1825579-11-0 | Molecular Weight | 316.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H24N4O2 |
|---|---|
| Molecular Weight | 316.4 |
| InChIKey | BPYYGFMJDBTOBW-UHFFFAOYSA-N |
| SMILES | C#CCN(CC#N)C(=O)C1CCCN(C(=O)NC2CCCC2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide? |
| A: Molecular formula of N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide is C17H24N4O2. |
| Q: What is the Chinese name of 1825579-11-0? |
| A: Chinese name of 1825579-11-0 is 1825579-11-0. |
| Q: What is the molecular weight of N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide? |
| A: Molecular weight of N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide is 316.4. |
| Q: What is the InChIKey of N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide? |
| A: InChIKey of N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide is BPYYGFMJDBTOBW-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide? |
| A: SMILES notation of N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide is C#CCN(CC#N)C(=O)C1CCCN(C(=O)NC2CCCC2)C1. |
| Q: What is the English name of N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide? |
| A: The English name of N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide is N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide. |
| Q: What is the CAS number of N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide? |
| A: CAS number of N3-(cyanomethyl)-N1-cyclopentyl-N3-(prop-2-yn-1-yl)piperidine-1,3-dicarboxamide is 1825579-11-0. |