6-Chloro-1-phenazinol
Modify Date: 2025-09-11 00:11:49
6-Chloro-1-phenazinol structure
|
Common Name | 6-Chloro-1-phenazinol | ||
|---|---|---|---|---|
| CAS Number | 18258-37-2 | Molecular Weight | 230.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Chloro-1-phenazinol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H7ClN2O |
|---|---|
| Molecular Weight | 230.65 |
| InChIKey | OSXZWEGELZCGAI-UHFFFAOYSA-N |
| SMILES | Oc1cccc2nc3c(Cl)cccc3nc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6-Chloro-1-phenazinol? |
| A: Molecular weight of 6-Chloro-1-phenazinol is 230.65. |
| Q: What is the InChIKey of 6-Chloro-1-phenazinol? |
| A: InChIKey of 6-Chloro-1-phenazinol is OSXZWEGELZCGAI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 18258-37-2? |
| A: Chinese name of 18258-37-2 is 18258-37-2. |
| Q: What is the molecular formula of 6-Chloro-1-phenazinol? |
| A: Molecular formula of 6-Chloro-1-phenazinol is C12H7ClN2O. |
| Q: What is the SMILES notation of 6-Chloro-1-phenazinol? |
| A: SMILES notation of 6-Chloro-1-phenazinol is Oc1cccc2nc3c(Cl)cccc3nc12. |
| Q: What is the CAS number of 6-Chloro-1-phenazinol? |
| A: CAS number of 6-Chloro-1-phenazinol is 18258-37-2. |
| Q: What is the English name of 6-Chloro-1-phenazinol? |
| A: The English name of 6-Chloro-1-phenazinol is 6-Chloro-1-phenazinol. |