N-[phenyl(sulfinyl)methyl]aniline
![N-[phenyl(sulfinyl)methyl]aniline Structure](https://image.chemsrc.com/caspic/344/18263-20-2.png)
N-[phenyl(sulfinyl)methyl]aniline structure
|
Common Name | N-[phenyl(sulfinyl)methyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 18263-20-2 | Molecular Weight | 229.29800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[phenyl(sulfinyl)methyl]aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11NOS |
|---|---|
| Molecular Weight | 229.29800 |
| Exact Mass | 229.05600 |
| PSA | 61.19000 |
| LogP | 3.42840 |
| InChIKey | UMACZOLBWWPDPF-UHFFFAOYSA-N |
| SMILES | O=S=C(Nc1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-[phenyl(sulfi... CAS#:18263-20-2 |
| Literature: Walter,W. et al. Justus Liebigs Annalen der Chemie, 1961 , vol. 643, p. 29 - 38 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Thiobenzanilid-S-oxyd |
| Benzenecarbothioamide,N-phenyl-,S-oxide |
| Thiobenzanilid-S-oxid |
| thiobenzanilide S-oxide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-[phenyl(sulfinyl)methyl]aniline? |
| A: SMILES notation of N-[phenyl(sulfinyl)methyl]aniline is O=S=C(Nc1ccccc1)c1ccccc1. |
| Q: What is the InChIKey of N-[phenyl(sulfinyl)methyl]aniline? |
| A: InChIKey of N-[phenyl(sulfinyl)methyl]aniline is UMACZOLBWWPDPF-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of N-[phenyl(sulfinyl)methyl]aniline? |
| A: Polar surface area (PSA) of N-[phenyl(sulfinyl)methyl]aniline is 61.19000. |
| Q: What is the LogP of N-[phenyl(sulfinyl)methyl]aniline? |
| A: LogP of N-[phenyl(sulfinyl)methyl]aniline is 3.42840. |
| Q: What is the molecular weight of N-[phenyl(sulfinyl)methyl]aniline? |
| A: Molecular weight of N-[phenyl(sulfinyl)methyl]aniline is 229.29800. |
| Q: What is the CAS number of N-[phenyl(sulfinyl)methyl]aniline? |
| A: CAS number of N-[phenyl(sulfinyl)methyl]aniline is 18263-20-2. |
| Q: What is the English name of N-[phenyl(sulfinyl)methyl]aniline? |
| A: The English name of N-[phenyl(sulfinyl)methyl]aniline is N-[phenyl(sulfinyl)methyl]aniline. |
| Q: What English synonyms does N-[phenyl(sulfinyl)methyl]aniline have? |
| A: English synonyms of N-[phenyl(sulfinyl)methyl]aniline: Thiobenzanilid-S-oxyd, Benzenecarbothioamide,N-phenyl-,S-oxide, Thiobenzanilid-S-oxid, thiobenzanilide S-oxide. |
| Q: What is the Chinese name of 18263-20-2? |
| A: Chinese name of 18263-20-2 is 18263-20-2. |
| Q: What is the molecular formula of N-[phenyl(sulfinyl)methyl]aniline? |
| A: Molecular formula of N-[phenyl(sulfinyl)methyl]aniline is C13H11NOS. |