bis(2-nitrophenyl)amine structure
|
Common Name | bis(2-nitrophenyl)amine | ||
|---|---|---|---|---|
| CAS Number | 18264-71-6 | Molecular Weight | 259.218 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 406.0±30.0 °C at 760 mmHg | |
| Molecular Formula | C12H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.3±24.6 °C | |
| Name | 2,2'-Dinitrodiphenylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 406.0±30.0 °C at 760 mmHg |
| Molecular Formula | C12H9N3O4 |
| Molecular Weight | 259.218 |
| Flash Point | 199.3±24.6 °C |
| Exact Mass | 259.059296 |
| PSA | 103.67000 |
| LogP | 3.83 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.693 |
| InChIKey | RENCFAVKFWOLJJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1Nc1ccccc1[N+](=O)[O-] |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2.2'-Dinitro-diphenylamin |
| Bis-(2-nitro-phenyl)-amin |
| Benzenamine, 2-nitro-N-(2-nitrophenyl)- |
| N-(2-Nitrophenyl)-2-nitroaniline |
| HN(o-PhNO2)2 |
| 2-Nitro-N-(2-nitrophenyl)aniline |
| 2,10-DODECADIYNE |
| bis(2-nitrophenyl)amine |
| bis-(2-nitro-phenyl)-amine |
| Benzenamine, 2-nitro-N- (2-nitrophenyl)- |
| di(o-nitrophenyl)amine |