7-fluoro-2-(1-phenylethyl)naphthalene-1-carboxylic acid structure
|
Common Name | 7-fluoro-2-(1-phenylethyl)naphthalene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1827-12-9 | Molecular Weight | 294.32000 | |
| Density | 1.242g/cm3 | Boiling Point | 464.9ºC at 760 mmHg | |
| Molecular Formula | C19H15FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.9ºC | |
| Name | 7-fluoro-2-(1-phenylethyl)naphthalene-1-carboxylic acid |
|---|
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 464.9ºC at 760 mmHg |
| Molecular Formula | C19H15FO2 |
| Molecular Weight | 294.32000 |
| Flash Point | 234.9ºC |
| Exact Mass | 294.10600 |
| PSA | 37.30000 |
| LogP | 4.82890 |
| Vapour Pressure | 1.93E-09mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | ZADLSQQNQYNMFR-UHFFFAOYSA-N |
| SMILES | CC(c1ccccc1)c1ccc2ccc(F)cc2c1C(=O)O |
|
~%
7-fluoro-2-(1-p... CAS#:1827-12-9 |
| Literature: Newman,M.S. et al. Journal of Organic Chemistry, 1961 , vol. 26, p. 2667 - 2669 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |