Ethanol,1,1'-thiobis[2,2,2-trichloro- structure
|
Common Name | Ethanol,1,1'-thiobis[2,2,2-trichloro- | ||
|---|---|---|---|---|
| CAS Number | 18271-97-1 | Molecular Weight | 328.85600 | |
| Density | 1.904g/cm3 | Boiling Point | 354.2ºC at 760mmHg | |
| Molecular Formula | C4H4Cl6O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168ºC | |
| Name | 2,2,2-trichloro-1-(2,2,2-trichloro-1-hydroxyethyl)sulfanylethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.904g/cm3 |
|---|---|
| Boiling Point | 354.2ºC at 760mmHg |
| Molecular Formula | C4H4Cl6O2S |
| Molecular Weight | 328.85600 |
| Flash Point | 168ºC |
| Exact Mass | 325.80600 |
| PSA | 65.76000 |
| LogP | 3.09680 |
| Vapour Pressure | 1.96E-06mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | HHMPFUOZAZUWSL-UHFFFAOYSA-N |
| SMILES | OC(SC(O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
|
~%
Ethanol,1,1'-th... CAS#:18271-97-1 |
| Literature: Lewis Journal of the Chemical Society, 1940 , p. 832 |
|
~%
Ethanol,1,1'-th... CAS#:18271-97-1 |
| Literature: Hagemann Chemische Berichte, 1872 , vol. 5, p. 154 |
|
~%
Ethanol,1,1'-th... CAS#:18271-97-1 |
| Literature: Harris,J.F. Journal of Organic Chemistry, 1965 , vol. 30, p. 2190 - 2195 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| DO3A-tris-tbutyl ester |
| Tri-tert-butyl 1,4,7,10-tetraazacyclododecane-1,4,7-triacetate |
| DO3A-t-Bu-ester |
| DO3A-tris-tert-butyl ester |
| chloral sulfhydrate |
| N',N",N'"-tris(t-Bu)DO3A |
| 2,2',2''-(1,4,7,10-tetraazacyclododecane-1,4,7-triyl)triacetic acid tri-tert-butyl ester |
| 1,4,7,10-Tetraazacyclododecane-1,4,7-triacetic Acid Tri-tert-butyl Ester |
| 1,4,7,10-tetraazacyclododecane-1,4,7-tris(t-butyl acetate) |
| Bis-(2,2,2-trichlor-1-hydroxy-aethyl)-sulfid |
| 2.2.2.2'.2'.2'-Hexachlor-1.1'-dihydroxy-diaethylsulfid |
| 2,2,2,2',2',2'-hexachloro-1,1'-sulfanediyl-bis-ethanol |
| Chloralsulfhydrat |
| DO3AtBu |
| bis-(2,2,2-trichloro-1-hydroxy-ethyl)-sulfide |
| tert-butyl (1,4,7,10-tetraaza-4,7-bis(((tert-butyl)oxycarbonyl)methyl)cyclododecyl)acetate |
| 1,4,7,10-tetraazacyclododecane-1,4,7-triacetic acid tris(1,1-dimethylethyl) ester |