2,2,2-trichloro-1-hydroxy-ethanesulfonic acid structure
|
Common Name | 2,2,2-trichloro-1-hydroxy-ethanesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 18272-04-3 | Molecular Weight | 252.45700 | |
| Density | 2.045g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C2H3Cl3NaO4S+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,2,2,2-trichloro-1-hydroxyethanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.045g/cm3 |
|---|---|
| Molecular Formula | C2H3Cl3NaO4S+ |
| Molecular Weight | 252.45700 |
| Exact Mass | 250.87200 |
| PSA | 82.98000 |
| LogP | 1.64360 |
| Index of Refraction | 1.586 |
| InChIKey | IVJRLEULVGZHHV-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)C(O)C(Cl)(Cl)Cl.[H-].[Na+] |
|
~%
2,2,2-trichloro... CAS#:18272-04-3 |
| Literature: Blackadder; Hinshelwood Journal of the Chemical Society, 1958 , p. 2720 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 42.42.42-Trichlor-41-oxy-1-methyl-4-aethyl-benzol |
| 2,2,2-trichloro-1-hydroxy-ethanesulfonic acid,sodium-salt |
| 2,2,2-Trichlor-1-p-tolyl-aethanol |
| 2,2,2-trichloro-1-p-tolyl-ethanol |
| 2,2,2-Trichlor-1-hydroxy-aethansulfonsaeure,Natrium-Salz |