5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride
Modify Date: 2026-09-13 11:13:47
5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride structure
|
Common Name | 5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1827217-56-0 | Molecular Weight | 309.59 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14BrClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14BrClN2O2 |
|---|---|
| Molecular Weight | 309.59 |
| InChIKey | DATLWVFXRAQQLR-UHFFFAOYSA-N |
| SMILES | Cl.O=C(NC1CCNCC1)c1ccc(Br)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride? |
| A: Molecular formula of 5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride is C10H14BrClN2O2. |
| Q: What is the Chinese name of 1827217-56-0? |
| A: Chinese name of 1827217-56-0 is 1827217-56-0. |
| Q: What is the InChIKey of 5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride? |
| A: InChIKey of 5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride is DATLWVFXRAQQLR-UHFFFAOYSA-N. |
| Q: What is the English name of 5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride? |
| A: The English name of 5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride is 5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride. |
| Q: What is the SMILES notation of 5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride? |
| A: SMILES notation of 5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride is Cl.O=C(NC1CCNCC1)c1ccc(Br)o1. |
| Q: What is the molecular weight of 5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride? |
| A: Molecular weight of 5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride is 309.59. |
| Q: What is the CAS number of 5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride? |
| A: CAS number of 5-Bromo-N-piperidin-4-ylfuran-2-carboxamide;hydrochloride is 1827217-56-0. |