2-ethoxy-5-oxidophenazin-5-ium structure
|
Common Name | 2-ethoxy-5-oxidophenazin-5-ium | ||
|---|---|---|---|---|
| CAS Number | 18274-46-9 | Molecular Weight | 240.25700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethoxy-5-oxidophenazin-5-ium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12N2O2 |
|---|---|
| Molecular Weight | 240.25700 |
| Exact Mass | 240.09000 |
| PSA | 47.58000 |
| LogP | 3.21520 |
| InChIKey | ZLZGGGKOLIRLQK-UHFFFAOYSA-N |
| SMILES | CCOc1ccc2c(c1)nc1ccccc1[n+]2[O-] |
|
~%
2-ethoxy-5-oxid... CAS#:18274-46-9 |
| Literature: Pachter; Kloetzel Journal of the American Chemical Society, 1952 , vol. 74, p. 971 |
|
~%
2-ethoxy-5-oxid... CAS#:18274-46-9 |
| Literature: Pachter; Kloetzel Journal of the American Chemical Society, 1952 , vol. 74, p. 971 |
| 2-Ethoxyphenazin-10-oxid |
| 2-Aethoxy-phenazin-5-oxid |
| 2-ethoxy-phenazine 5-oxide |
| Phenazine,2-ethoxy-,5-oxide |