Pentanoic acid,2-(ethoxyiminomethyl)-2-fluoro-, ethyl ester structure
|
Common Name | Pentanoic acid,2-(ethoxyiminomethyl)-2-fluoro-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 18283-03-9 | Molecular Weight | 219.25300 | |
| Density | 1.06g/cm3 | Boiling Point | 243.7ºC at 760mmHg | |
| Molecular Formula | C10H18FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.2ºC | |
| Name | ethyl 2-(ethoxy(imino)methyl)-2-fluoropentanoate |
|---|
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 243.7ºC at 760mmHg |
| Molecular Formula | C10H18FNO3 |
| Molecular Weight | 219.25300 |
| Flash Point | 101.2ºC |
| Exact Mass | 219.12700 |
| PSA | 59.38000 |
| LogP | 2.17140 |
| Vapour Pressure | 0.0317mmHg at 25°C |
| Index of Refraction | 1.436 |
| InChIKey | PBQJWTWKVNHMCV-UHFFFAOYSA-N |
| SMILES | CCCC(F)(C(=N)OCC)C(=O)OCC |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |