ethyl 2-(ethoxycarbonimidoyl)-2-fluoro-3-methyl-butanoate structure
|
Common Name | ethyl 2-(ethoxycarbonimidoyl)-2-fluoro-3-methyl-butanoate | ||
|---|---|---|---|---|
| CAS Number | 18283-04-0 | Molecular Weight | 219.25300 | |
| Density | 1.06g/cm3 | Boiling Point | 238.4ºC at 760 mmHg | |
| Molecular Formula | C10H18FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 98ºC | |
| Name | ethyl 2-(ethoxy(imino)methyl)-2-fluoro-3-methylbutanoate |
|---|
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 238.4ºC at 760 mmHg |
| Molecular Formula | C10H18FNO3 |
| Molecular Weight | 219.25300 |
| Flash Point | 98ºC |
| Exact Mass | 219.12700 |
| PSA | 59.38000 |
| LogP | 2.02730 |
| Vapour Pressure | 0.0425mmHg at 25°C |
| Index of Refraction | 1.437 |
| InChIKey | QNODYTBORJKIFK-UHFFFAOYSA-N |
| SMILES | CCOC(=N)C(F)(C(=O)OCC)C(C)C |
|
~%
ethyl 2-(ethoxy... CAS#:18283-04-0 |
| Literature: Gershon,H. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 536 - 541 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |