Hexanoic acid,2-(ethoxyiminomethyl)-2-fluoro-, ethyl ester structure
|
Common Name | Hexanoic acid,2-(ethoxyiminomethyl)-2-fluoro-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 18283-05-1 | Molecular Weight | 233.28000 | |
| Density | 1.04g/cm3 | Boiling Point | 262.6ºC at 760mmHg | |
| Molecular Formula | C11H20FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.6ºC | |
| Name | ethyl 2-(ethoxy(imino)methyl)-2-fluorohexanoate |
|---|
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 262.6ºC at 760mmHg |
| Molecular Formula | C11H20FNO3 |
| Molecular Weight | 233.28000 |
| Flash Point | 112.6ºC |
| Exact Mass | 233.14300 |
| PSA | 59.38000 |
| LogP | 2.56150 |
| Vapour Pressure | 0.0108mmHg at 25°C |
| Index of Refraction | 1.44 |
| InChIKey | GYINKEPJDJUXAQ-UHFFFAOYSA-N |
| SMILES | CCCCC(F)(C(=N)OCC)C(=O)OCC |
|
~%
Hexanoic acid,2... CAS#:18283-05-1 |
| Literature: Gershon,H. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 536 - 541 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |