2-carbamoyl-2-fluoro-3-phenyl-propanoic acid structure
|
Common Name | 2-carbamoyl-2-fluoro-3-phenyl-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 18283-40-4 | Molecular Weight | 211.19000 | |
| Density | 1.352g/cm3 | Boiling Point | 431.6ºC at 760 mmHg | |
| Molecular Formula | C10H10FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.8ºC | |
| Name | 3-amino-2-benzyl-2-fluoro-3-oxopropanoic acid |
|---|
| Density | 1.352g/cm3 |
|---|---|
| Boiling Point | 431.6ºC at 760 mmHg |
| Molecular Formula | C10H10FNO3 |
| Molecular Weight | 211.19000 |
| Flash Point | 214.8ºC |
| Exact Mass | 211.06400 |
| PSA | 80.39000 |
| LogP | 1.20760 |
| Vapour Pressure | 3.24E-08mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | UGIKGQYNVDVIMJ-UHFFFAOYSA-N |
| SMILES | NC(=O)C(F)(Cc1ccccc1)C(=O)O |
|
~%
2-carbamoyl-2-f... CAS#:18283-40-4 |
| Literature: Gershon,H. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 536 - 541 |
|
~%
2-carbamoyl-2-f... CAS#:18283-40-4 |
| Literature: Gershon,H. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 536 - 541 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |