(3-chloropropyl)pentamethyldisiloxane structure
|
Common Name | (3-chloropropyl)pentamethyldisiloxane | ||
|---|---|---|---|---|
| CAS Number | 18291-27-5 | Molecular Weight | 224.87600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H21ClOSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloropropyl-dimethyl-trimethylsilyloxysilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H21ClOSi2 |
|---|---|
| Molecular Weight | 224.87600 |
| Exact Mass | 224.08200 |
| PSA | 9.23000 |
| LogP | 3.67190 |
| InChIKey | GSSWFBLVISCYBP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](C)(C)CCCCl |
| HS Code | 2934999090 |
|---|
|
~%
(3-chloropropyl... CAS#:18291-27-5 |
| Literature: Ryan,J.W. et al. Journal of the American Chemical Society, 1960 , vol. 82, p. 3601 - 3604 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Disiloxane,(3-chloropropyl)pentamethyl |
| (3-CHLOROPROPYL)PENTAMETHYLDISILOXANE |
| 1-(3-Chlorpropyl)-pentamethyldisiloxan |