4-((6-((3-Chloropropanoyl)oxy)hexyl)oxy)benzoic acid structure
|
Common Name | 4-((6-((3-Chloropropanoyl)oxy)hexyl)oxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 182922-18-5 | Molecular Weight | 328.78800 | |
| Density | N/A | Boiling Point | 487.5°C at 760 mmHg | |
| Molecular Formula | C16H21ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.7°C | |
| Name | 4-[6-(3-chloropropanoyloxy)hexoxy]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 487.5°C at 760 mmHg |
|---|---|
| Molecular Formula | C16H21ClO5 |
| Molecular Weight | 328.78800 |
| Flash Point | 248.7°C |
| Exact Mass | 328.10800 |
| PSA | 72.83000 |
| LogP | 3.49610 |
| Vapour Pressure | 2.55E-10mmHg at 25°C |
| InChIKey | YZNWEIUTUQFLLH-UHFFFAOYSA-N |
| SMILES | O=C(CCCl)OCCCCCCOc1ccc(C(=O)O)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,4-[[6-(3-chloro-1-oxopropoxy)hexyl]oxy] |
| 4-((6-((3-Chloropropanoyl)oxy)hexyl)oxy)benzoic acid |