4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl]
Modify Date: 2025-09-09 17:38:32
![4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl] Structure](https://www.chemsrc.com/extcaspic/239/1829550-78-8.png)
4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl] structure
|
Common Name | 4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 1829550-78-8 | Molecular Weight | 393.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H31N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H31N3O3S |
|---|---|
| Molecular Weight | 393.5 |
| InChIKey | VKXNBDJUIGEYIY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)CCC2CCNCC2)cc1S(=O)(=O)N1CCCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl]? |
| A: Molecular weight of 4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl] is 393.5. |
| Q: What is the SMILES notation of 4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl]? |
| A: SMILES notation of 4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl] is Cc1ccc(NC(=O)CCC2CCNCC2)cc1S(=O)(=O)N1CCCCC1. |
| Q: What is the English name of 4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl]? |
| A: The English name of 4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl] is 4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl]. |
| Q: What is the InChIKey of 4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl]? |
| A: InChIKey of 4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl] is VKXNBDJUIGEYIY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl]? |
| A: Molecular formula of 4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl] is C20H31N3O3S. |
| Q: What is the Chinese name of 1829550-78-8? |
| A: Chinese name of 1829550-78-8 is 1829550-78-8. |
| Q: What is the CAS number of 4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl]? |
| A: CAS number of 4-Piperidinepropanamide, N-[4-methyl-3-(1-piperidinylsulfonyl)phenyl] is 1829550-78-8. |