HBV-IN-38
Modify Date: 2025-08-25 17:04:10
HBV-IN-38 structure
|
Common Name | HBV-IN-38 | ||
|---|---|---|---|---|
| CAS Number | 1834483-86-1 | Molecular Weight | 487.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16F3N5O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HBV-IN-38HBV-IN-38 (Example 193) is an HBV DNA inhibitor (EC50≤100nM). HBV-IN-38 can be used to study viral infections[1]. |
| Name | HBV-IN-38 |
|---|
| Description | HBV-IN-38 (Example 193) is an HBV DNA inhibitor (EC50≤100nM). HBV-IN-38 can be used to study viral infections[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Haiying He, et al. Dihydropyrimido loop derivative as hbv inhibitor. Patent WO2015180631A1. |
| Molecular Formula | C18H16F3N5O4S2 |
|---|---|
| Molecular Weight | 487.48 |
| InChIKey | HGPLRZDHSVWCMZ-AYVTZFPOSA-N |
| SMILES | COC(=O)C1=C2CC(NS(N)(=O)=O)CN2C(c2nccs2)=NC1c1ccc(F)c(F)c1F |