(Pyr3)-Amyloid β-Protein (3-42) ammonium salt
Modify Date: 2025-08-25 15:28:40
(Pyr3)-Amyloid β-Protein (3-42) ammonium salt structure
|
Common Name | (Pyr3)-Amyloid β-Protein (3-42) ammonium salt | ||
|---|---|---|---|---|
| CAS Number | 183449-57-2 | Molecular Weight | 4309.86 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C196H299N53O55S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of (Pyr3)-Amyloid β-Protein (3-42) ammonium salt(Pyr3)-Amyloid β-Protein (3-42) is the predominant amyloid β-peptide structure deposited in human brain of Alzheimer's disease and Down's syndrome patients. (Pyr3)-Amyloid β-Protein (3-42) is suggested to accumulate in the brain and to trigger the formation of insoluble amyloid β-peptide deposits[1]. |
| Name | [pGlu3]-Amyloid β-Protein Fragment 3-42 |
|---|---|
| Synonym | More Synonyms |
| Description | (Pyr3)-Amyloid β-Protein (3-42) is the predominant amyloid β-peptide structure deposited in human brain of Alzheimer's disease and Down's syndrome patients. (Pyr3)-Amyloid β-Protein (3-42) is suggested to accumulate in the brain and to trigger the formation of insoluble amyloid β-peptide deposits[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C196H299N53O55S |
|---|---|
| Molecular Weight | 4309.86 |
| Exact Mass | 4307.19000 |
| PSA | 1722.65000 |
| LogP | 5.49010 |
| Appearance of Characters | solid |
| InChIKey | KGOBZCKPDJHJMH-UHFFFAOYSA-N |
| SMILES | CCC(C)C(NC(=O)C(C)NC(=O)CNC(=O)C(CCCCN)NC(=O)C(CC(N)=O)NC(=O)C(CO)NC(=O)CNC(=O)C(NC(=O)C(CC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(C)NC(=O)C(Cc1ccccc1)NC(=O)C(Cc1ccccc1)NC(=O)C(NC(=O)C(CC(C)C)NC(=O)C(CCCCN)NC(=O)C(CCC(N)=O)NC(=O)C(Cc1c[nH]cn1)NC(=O)C(Cc1c[nH]cn1)NC(=O)C(NC(=O)C(CCC(=O)O)NC(=O)C(Cc1ccc(O)cc1)NC(=O)CNC(=O)C(CO)NC(=O)C(CC(=O)O)NC(=O)C(Cc1c[nH]cn1)NC(=O)C(CCCNC(=N)N)NC(=O)C(Cc1ccccc1)NC(=O)C1CCC(=O)N1)C(C)C)C(C)C)C(C)C)C(=O)NC(C(=O)NCC(=O)NC(CC(C)C)C(=O)NC(CCSC)C(=O)NC(C(=O)NCC(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C)C(=O)O)C(C)CC)C(C)C)C(C)C)C(C)C)C(C)CC |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| pyr-phe-arg-his-asp-ser-gly-tyr-glu-val-his-his-gln-lys-leu-val-phe-phe-ala-glu-asp-val-gly-ser-asn-lys-gly-ala-ile-ile-gly-leu-met-val-gly-gly-val-val-ile-ala trifluoroacetate |
| MFCD03457978 |
| Pyr-FRHDSGYEVHHQKLVFFAEDVGSNKGAIIGLMVGGVVIA |