N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride
Modify Date: 2026-09-21 00:00:03
N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride structure
|
Common Name | N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1836059-82-5 | Molecular Weight | 315.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16Cl2N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16Cl2N2O3S |
|---|---|
| Molecular Weight | 315.22 |
| InChIKey | DTMQLFQDRYYDHC-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)NCCCN)cc1Cl.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride? |
| A: SMILES notation of N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride is COc1ccc(S(=O)(=O)NCCCN)cc1Cl.Cl. |
| Q: What is the molecular weight of N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride? |
| A: Molecular weight of N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride is 315.22. |
| Q: What is the InChIKey of N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride? |
| A: InChIKey of N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride is DTMQLFQDRYYDHC-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1836059-82-5? |
| A: Chinese name of 1836059-82-5 is 1836059-82-5. |
| Q: What is the English name of N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride? |
| A: The English name of N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride is N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride. |
| Q: What is the CAS number of N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride? |
| A: CAS number of N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride is 1836059-82-5. |
| Q: What is the molecular formula of N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride? |
| A: Molecular formula of N-(3-Aminopropyl)-3-chloro-4-methoxybenzenesulfonamide hydrochloride is C10H16Cl2N2O3S. |