CPI-1189 structure
|
Common Name | CPI-1189 | ||
|---|---|---|---|---|
| CAS Number | 183619-38-7 | Molecular Weight | 234.294 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 458.3±28.0 °C at 760 mmHg | |
| Molecular Formula | C13H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.9±24.2 °C | |
Use of CPI-1189CPI-1189 is a TNF-α release inhibitor with antioxidant and neuroprotective properties. CPI-1189 is used for researches of HIV-associated neurotoxicity and thus is a candidate for neuroprotective therapy in humans suffered from HIV-associated CNS disease[1][2]. |
| Name | 4-Acetamido-N-tert-butylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Description | CPI-1189 is a TNF-α release inhibitor with antioxidant and neuroprotective properties. CPI-1189 is used for researches of HIV-associated neurotoxicity and thus is a candidate for neuroprotective therapy in humans suffered from HIV-associated CNS disease[1][2]. |
|---|---|
| Related Catalog | |
| References |
[1]. Müller T. CPI-1189. Centaur. Curr Opin Investig Drugs. 2002 Dec;3(12):1763-7. |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 458.3±28.0 °C at 760 mmHg |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.294 |
| Flash Point | 183.9±24.2 °C |
| Exact Mass | 234.136826 |
| LogP | 1.38 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | DJKNRCWSXSZACF-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(=O)NC(C)(C)C)cc1 |
| Storage condition | -20℃ |
| 4-Acetamido-N-(2-methyl-2-propanyl)benzamide |
| Benzamide, 4-(acetylamino)-N-(1,1-dimethylethyl)- |
| MFCD00774476 |
| 4-Acetamido-N-tert-butylbenzamide |
| CPI-1189 |
| REN-1189 |