4-(ethoxymethoxy)-N,N-diethyl-1,3-benzodioxole-5-carboxamide structure
|
Common Name | 4-(ethoxymethoxy)-N,N-diethyl-1,3-benzodioxole-5-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 183674-34-2 | Molecular Weight | 295.33100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(ethoxymethoxy)-N,N-diethyl-1,3-benzodioxole-5-carboxamide |
|---|
| Molecular Formula | C15H21NO5 |
|---|---|
| Molecular Weight | 295.33100 |
| Exact Mass | 295.14200 |
| PSA | 57.23000 |
| LogP | 2.27010 |
| InChIKey | IPTYSPPOWCEZOQ-UHFFFAOYSA-N |
| SMILES | CCOCOc1c(C(=O)N(CC)CC)ccc2c1OCO2 |
|
~%
4-(ethoxymethox... CAS#:183674-34-2 |
| Literature: Hudlicky, Tomas; Tian, Xinrong; Koenigsberger, Kurt; Maurya, Rakesh; Rouden, Jacques; Fan, Boreas Journal of the American Chemical Society, 1996 , vol. 118, # 44 p. 10752 - 10765 |
|
~%
4-(ethoxymethox... CAS#:183674-34-2 |
| Literature: Hudlicky, Tomas; Tian, Xinrong; Koenigsberger, Kurt; Maurya, Rakesh; Rouden, Jacques; Fan, Boreas Journal of the American Chemical Society, 1996 , vol. 118, # 44 p. 10752 - 10765 |