N-[2-(1,2-Dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide structure
|
Common Name | N-[2-(1,2-Dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 183675-86-7 | Molecular Weight | 359.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20F3N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(1,2-Dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide |
|---|
| Molecular Formula | C16H20F3N3OS |
|---|---|
| Molecular Weight | 359.4 |
| InChIKey | NXJYCVLHPIOEMR-UHFFFAOYSA-N |
| SMILES | CCC(C)C(C)c1sccc1NC(=O)c1cn(C)nc1C(F)(F)F |
|
Name: Fungicidal activity against Magnaporthe grisea spores inoculated on leaves of compoun...
Source: ChEMBL
Target: Pyricularia grisea
External Id: CHEMBL3059222
|
|
Name: Fungicidal activity against Puccinia recondita spores inoculated on leaves of compoun...
Source: ChEMBL
Target: Puccinia recondita
External Id: CHEMBL3059224
|
|
Name: Fungicidal activity against Podosphaera xanthii (powdery mildew) spores inoculated on...
Source: ChEMBL
Target: Podosphaera xanthii
External Id: CHEMBL3059226
|
|
Name: Fungicidal activity against Botryotinia fuckeliana spores inoculated on leaves of com...
Source: ChEMBL
Target: Botrytis cinerea
External Id: CHEMBL3059228
|