Ethyl 4-(ethoxycarbonyl)piperidine-1-acetate structure
|
Common Name | Ethyl 4-(ethoxycarbonyl)piperidine-1-acetate | ||
|---|---|---|---|---|
| CAS Number | 1838-39-7 | Molecular Weight | 243.29900 | |
| Density | 1.077g/cm3 | Boiling Point | 309.5ºC at 760mmHg | |
| Molecular Formula | C12H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141ºC | |
| Name | ethyl 1-(2-ethoxy-2-oxoethyl)piperidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.077g/cm3 |
|---|---|
| Boiling Point | 309.5ºC at 760mmHg |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.29900 |
| Flash Point | 141ºC |
| Exact Mass | 243.14700 |
| PSA | 55.84000 |
| LogP | 0.76250 |
| Vapour Pressure | 0.000637mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | OBXXSRPAQLOXJN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1CCC(C(=O)OCC)CC1 |
| HS Code | 2933399090 |
|---|
|
~%
Ethyl 4-(ethoxy... CAS#:1838-39-7 |
| Literature: Journal of the Chemical Society, , p. 1989 Helvetica Chimica Acta, , vol. 37, p. 1672,1676 |
|
~%
Ethyl 4-(ethoxy... CAS#:1838-39-7 |
| Literature: Helvetica Chimica Acta, , vol. 37, p. 1672,1676 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1-Carbethoxymethyl-4-carbethoxy-piperidin |
| Ethyl-1-ethoxycarbonylmethyl-isonipecotinat |
| 1-Aethoxycarbonylmethyl-piperidin-4-carbonsaeure-aethylester |
| 1-ethoxycarbonylmethyl-piperidine-4-carboxylic acid ethyl ester |
| 4-Ethoxycarbonyl-piperidin-essigsaeure-1-ethylester |
| 1-Ethoxycarbonylmethyl-4-ethoxycarbonyl-piperidin |