(2E)-3-[4-(Trifluoromethoxy)phenyl]acrylaldehyde structure
|
Common Name | (2E)-3-[4-(Trifluoromethoxy)phenyl]acrylaldehyde | ||
|---|---|---|---|---|
| CAS Number | 183800-94-4 | Molecular Weight | 216.157 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 264.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H7F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.5±20.8 °C | |
| Name | 4-(trifluoromethoxy)cinnamic aldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 264.6±35.0 °C at 760 mmHg |
| Molecular Formula | C10H7F3O2 |
| Molecular Weight | 216.157 |
| Flash Point | 110.5±20.8 °C |
| Exact Mass | 216.039810 |
| PSA | 26.30000 |
| LogP | 3.10 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.500 |
| InChIKey | GGNLWQJCNHVNJG-OWOJBTEDSA-N |
| SMILES | O=CC=Cc1ccc(OC(F)(F)F)cc1 |
|
~%
(2E)-3-[4-(Trif... CAS#:183800-94-4 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 48, # 5 p. 694 - 707 |
|
~%
(2E)-3-[4-(Trif... CAS#:183800-94-4 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 48, # 5 p. 694 - 707 |
|
~%
(2E)-3-[4-(Trif... CAS#:183800-94-4 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 48, # 5 p. 694 - 707 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| trans-4-(trifluoromethoxy)cinnamaldehyde |
| (2E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoyl chloride |
| 4-trifluoromethoxycinnamoyl chloride |
| 3-(4-trifluoromethoxyphenyl)propenal |
| (2E)-3-[4-(Trifluoromethoxy)phenyl]acrylaldehyde |
| 2-Propenal, 3-[4-(trifluoromethoxy)phenyl]-, (2E)- |
| 3-[4-(Trifluoromethoxy)phenyl]acryloyl chloride |