2-Cyclohexen-1-one,6-methyl-3-(1-methylethyl)-, 2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | 2-Cyclohexen-1-one,6-methyl-3-(1-methylethyl)-, 2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 18384-06-0 | Molecular Weight | 332.35400 | |
| Density | 1.326g/cm3 | Boiling Point | 462.469ºC at 760 mmHg | |
| Molecular Formula | C16H20N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.493ºC | |
| Name | N-[(Z)-(6-methyl-3-propan-2-ylcyclohex-2-en-1-ylidene)amino]-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.326g/cm3 |
|---|---|
| Boiling Point | 462.469ºC at 760 mmHg |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.35400 |
| Flash Point | 233.493ºC |
| Exact Mass | 332.14800 |
| PSA | 116.03000 |
| LogP | 5.40260 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.62 |
| InChIKey | DGNWYMRUTVTYEJ-OBGWFSINSA-N |
| SMILES | CC(C)C1=CC(=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C(C)CC1 |
|
~%
2-Cyclohexen-1-... CAS#:18384-06-0 |
| Literature: Birch; Mukherji Journal of the Chemical Society, 1949 , p. 2531,2534 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Isopropyl-6-methylcyclohex-2-enon-<2,4-dinitro-phenylhydrazon> |
| p-Menth-3-en-2-on-(2,4-dinitro-phenylhydrazon) |
| p-menth-3-en-2-one-(2,4-dinitro-phenylhydrazone) |
| Carvenon-2,4-dinitrophenylhydrazon |