1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate
Modify Date: 2026-09-13 16:16:42
1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate structure
|
Common Name | 1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate | ||
|---|---|---|---|---|
| CAS Number | 1838654-20-8 | Molecular Weight | 262.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H22O3 |
|---|---|
| Molecular Weight | 262.34 |
| InChIKey | SHQRXMXVWBHHPO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Cc1ccc(C2(C)COC2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate? |
| A: Molecular formula of 1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate is C16H22O3. |
| Q: What is the CAS number of 1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate? |
| A: CAS number of 1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate is 1838654-20-8. |
| Q: What is the Chinese name of 1838654-20-8? |
| A: Chinese name of 1838654-20-8 is 1838654-20-8. |
| Q: What is the English name of 1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate? |
| A: The English name of 1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate is 1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate. |
| Q: What is the SMILES notation of 1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate? |
| A: SMILES notation of 1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate is CC(C)(C)OC(=O)Cc1ccc(C2(C)COC2)cc1. |
| Q: What is the InChIKey of 1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate? |
| A: InChIKey of 1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate is SHQRXMXVWBHHPO-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate? |
| A: Molecular weight of 1,1-Dimethylethyl 4-(3-methyl-3-oxetanyl)benzeneacetate is 262.34. |