1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate
Modify Date: 2025-08-26 21:58:02
![1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate Structure](https://www.chemsrc.com/extcaspic/069/1838654-40-2.png)
1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate structure
|
Common Name | 1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate | ||
|---|---|---|---|---|
| CAS Number | 1838654-40-2 | Molecular Weight | 292.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H24O4 |
|---|---|
| Molecular Weight | 292.4 |
| InChIKey | NZUIQGUAFWRQRO-UHFFFAOYSA-N |
| SMILES | CC1(COc2ccc(CC(=O)OC(C)(C)C)cc2)COC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate? |
| A: CAS number of 1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate is 1838654-40-2. |
| Q: What is the English name of 1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate? |
| A: The English name of 1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate is 1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate. |
| Q: What is the InChIKey of 1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate? |
| A: InChIKey of 1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate is NZUIQGUAFWRQRO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate? |
| A: SMILES notation of 1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate is CC1(COc2ccc(CC(=O)OC(C)(C)C)cc2)COC1. |
| Q: What is the molecular formula of 1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate? |
| A: Molecular formula of 1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate is C17H24O4. |
| Q: What is the molecular weight of 1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate? |
| A: Molecular weight of 1,1-Dimethylethyl 4-[(3-methyl-3-oxetanyl)methoxy]benzeneacetate is 292.4. |
| Q: What is the Chinese name of 1838654-40-2? |
| A: Chinese name of 1838654-40-2 is 1838654-40-2. |