bis(3-chloro-2-methylpropyl)-methyl-trimethylsilyloxysilane structure
|
Common Name | bis(3-chloro-2-methylpropyl)-methyl-trimethylsilyloxysilane | ||
|---|---|---|---|---|
| CAS Number | 18388-70-0 | Molecular Weight | 315.42700 | |
| Density | 0.989 g/cm3 | Boiling Point | 130-135ºC 5mm | |
| Molecular Formula | C12H28Cl2OSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 107.3ºC | |
| Name | bis(3-chloro-2-methylpropyl)-methyl-trimethylsilyloxysilane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.989 g/cm3 |
|---|---|
| Boiling Point | 130-135ºC 5mm |
| Molecular Formula | C12H28Cl2OSi2 |
| Molecular Weight | 315.42700 |
| Flash Point | 107.3ºC |
| Exact Mass | 314.10600 |
| PSA | 9.23000 |
| LogP | 5.16300 |
| Vapour Pressure | 0.00402mmHg at 25°C |
| Index of Refraction | 1.4528 |
| InChIKey | KECGSMRYEXLPFD-UHFFFAOYSA-N |
| SMILES | CC(CCl)C[Si](C)(C)O[Si](C)(C)CC(C)CCl |
| HS Code | 2934999090 |
|---|
|
~%
bis(3-chloro-2-... CAS#:18388-70-0 |
| Literature: Journal of the American Chemical Society, , vol. 82, p. 3601 - 3604 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Bis-(3-chlor-2-methylpropyl)-tetramethyl-disiloxan |
| 1,3-bis-(3-chloro-2-methyl-propyl)-1,1,3,3-tetramethyl-disiloxane |
| BIS(3-CHLOROISOBUTYL)TETRAMETHYLDISILOXANE |