9,11-Octadecadienoicacid structure
|
Common Name | 9,11-Octadecadienoicacid | ||
|---|---|---|---|---|
| CAS Number | 1839-11-8 | Molecular Weight | 280.44500 | |
| Density | 0.911g/cm3 | Boiling Point | 381.6ºC at 760 mmHg | |
| Molecular Formula | C18H32O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.5ºC | |
| Name | octadeca-9,11-dienoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.911g/cm3 |
|---|---|
| Boiling Point | 381.6ºC at 760 mmHg |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.44500 |
| Flash Point | 278.5ºC |
| Exact Mass | 280.24000 |
| PSA | 37.30000 |
| LogP | 5.88450 |
| Vapour Pressure | 7.01E-07mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | JBYXPOFIGCOSSB-UHFFFAOYSA-N |
| SMILES | CCCCCCC=CC=CCCCCCCCC(=O)O |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 11-TRANS,9-CIS-CONJUGATEDLINOLEICACID |
| cis-9,trans-11 conjugated linoleic acid |
| 9,11-cis,trans-octadecanoic acid |
| 9-cis-11-trans-linoleic acid |
| delta9,11-Octadecadienoic acid |
| Nouracid de 554 |
| trans-11-conjugated linoleic acid |
| Ricineic acid |
| Ricinenic acid |